A0704912
2-Acetamidoacrylic acid , 98% , 5429-56-1
Synonym(s):
N-Acetyldehydroalanine
CAS NO.：5429-56-1
Empirical Formula: C5H7NO3
Molecular Weight: 129.11
MDL number: MFCD00004257
EINECS: 226-583-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB84.00 | In Stock |
|
| 5G | RMB232.80 | In Stock |
|
| 25G | RMB1002.40 | In Stock |
|
| 100g | RMB3119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 185-186 °C (dec.) (lit.) |
| Boiling point: | 239.15°C (rough estimate) |
| Density | 1.3816 (rough estimate) |
| refractive index | 1.4220 (estimate) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.53±0.11(Predicted) |
| color | Off-White to Pale Grey |
| Water Solubility | hardly soluble |
| BRN | 1812032 |
| InChI | InChI=1S/C5H7NO3/c1-3(5(8)9)6-4(2)7/h1H2,2H3,(H,6,7)(H,8,9) |
| InChIKey | UFDFFEMHDKXMBG-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(NC(C)=O)=C |
| CAS DataBase Reference | 5429-56-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Propenoic acid, 2-(acetylamino)-(5429-56-1) |
Description and Uses
2-Acetamidoacrylic acid is used as an antioxidant as well as a monomer.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29241900 |
