PRODUCT Properties
| Melting point: | 280-285 °C(lit.) |
| Boiling point: | 286.06°C (rough estimate) |
| Density | 1.208 |
| refractive index | 1.4500 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | H2O: 0.1 g/mL, clear |
| pka | 3.16±0.10(Predicted) |
| form | Solid |
| color | white |
| BRN | 1724813 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C6H12N2O3/c1-3(7)5(9)8-4(2)6(10)11/h3-4H,7H2,1-2H3,(H,8,9)(H,10,11)/t3-,4-/m0/s1 |
| InChIKey | DEFJQIDDEAULHB-IMJSIDKUSA-N |
| SMILES | C[C@H](N)C(=O)N[C@@H](C)C(O)=O |
| CAS DataBase Reference | 1948-31-8(CAS DataBase Reference) |
Description and Uses
L-Alanyl-L-alanine is usually used as a model dipeptide in physicochemical studies of processes such as the effects of pH (protonation) on conformation.
Safety
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 2924190002 |
| Storage Class | 11 - Combustible Solids |
