A0711312
Azadirachtin , Analysis standard , 11141-17-6
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB1581.60 | In Stock |
|
| 25MG | RMB6319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 159°C |
| alpha | D -53° (c = 0.5 in CHCl3) |
| Boiling point: | 792.4±60.0 °C(Predicted) |
| Density | 1.51 |
| storage temp. | −20°C |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| pka | 9.78±0.70(Predicted) |
| form | Solid |
| color | White to Pale Yellow |
| Merck | 13,896 |
| Stability: | Light Sensitive |
| Major Application | agriculture environmental |
| InChIKey | TWGPOIQWWGNBKW-POEZYEDVSA-N |
| SMILES | [H]C1([H])C2OC3([H])OC=CC3(O)C1C4(C)OC24[C@@]5(C)[C@@H](O)[C@@H]6OC[C@]7([C@H](C[C@H](OC(=O)C(C)=CC)[C@]8(COC(O)([C@H]58)C(=O)OC)[C@@]67[H])OC(C)=O)C(=O)OC |
| LogP | 1.090 |
| CAS DataBase Reference | 11141-17-6 |
| EPA Substance Registry System | Azadirachtin A (11141-17-6) |
Description and Uses
Kernel extracts from the Indian neem tree (Azadirachta indica) have insecticidal and insect-repellent properties. The key active ingredient is azadirachtin, a nortriterpenoid that exhibits insect growth regulator effects but no adulticidal activity.
Azadirachtin is a tetranortriterpinoid isolated from the seeds of the neem tree. Highly active insect feeding deterrent and growth regulator.It is used experimentally as insect control agent.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H410 |
| Precautionary statements | P261-P272-P273-P280-P302+P352-P333+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 22 |
| Safety Statements | 22-45 |
| RIDADR | 3077 |
| WGK Germany | 3 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 13021920 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1B |
| Hazardous Substances Data | 11141-17-6(Hazardous Substances Data) |
