A0712012
2-Amino-3-pyridinecarboxaldehyde , 97% , 7521-41-7
CAS NO.:7521-41-7
Empirical Formula: C6H6N2O
Molecular Weight: 122.12
MDL number: MFCD01830382
EINECS: 626-730-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB135.20 | In Stock |
|
| 25g | RMB575.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-102 °C (lit.) |
| Boiling point: | 290.7±25.0 °C(Predicted) |
| Density | 1.264±0.06 g/cm3(Predicted) |
| Flash point: | >300℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in Ether, Ethyl acetate, Chloroform (Slightly), Methanol (Slightly) |
| pka | 4.99±0.36(Predicted) |
| form | Powder, Crystals and/or Chunks |
| color | Yellow to light brown |
| Water Solubility | insoluble |
| Sensitive | Air Sensitive |
| BRN | 109598 |
| InChI | InChI=1S/C6H6N2O/c7-6-5(4-9)2-1-3-8-6/h1-4H,(H2,7,8) |
| InChIKey | NXMFJCRMSDRXLD-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=CC=C1C=O |
| CAS DataBase Reference | 7521-41-7(CAS DataBase Reference) |
Description and Uses
2-Aminonicotinaldehyde is commonly employed as a starting material for a wide variety of N-heterocyclic compounds (e.g. β-nicotyrine [N445000]) . 2-Aminonicotinaldehyde is also used as a reagent to synthesize hydrazones (e.g.thionaphthenquinone 3-hydrazone [T367720]), which possess antituburcular properties.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | II |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




