A0714812
2-Amino-5-bromopyrazine , 98% , 59489-71-3
CAS NO.:59489-71-3
Empirical Formula: C4H4BrN3
Molecular Weight: 174
MDL number: MFCD00235015
EINECS: 626-202-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB29.60 | In Stock |
|
| 25G | RMB120.80 | In Stock |
|
| 100g | RMB415.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113-117 °C (lit.) |
| Boiling point: | 274.2±35.0 °C(Predicted) |
| Density | 1.844±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Ethanol, Ethyl Acetate, Methanol |
| form | Brown Needles |
| pka | 1.66±0.10(Predicted) |
| color | Light yellow to Brown |
| InChI | InChI=1S/C4H4BrN3/c5-3-1-8-4(6)2-7-3/h1-2H,(H2,6,8) |
| InChIKey | KRRTXVSBTPCDOS-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C(Br)N=C1 |
| CAS DataBase Reference | 59489-71-3(CAS DataBase Reference) |
Description and Uses
Used without prior protection of the amino group in a palladium-catalyzed cross-coupling with pyridylboronic acids leading to pyrazinylpyridines.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/38-43-44-36/37/38-20/21/22 |
| Safety Statements | 26-37/39-45-36/37/39-22-36/ |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |






