A0715012
L-β-Homophenylalanine hydrochloride , 98% , 138165-77-2
Synonym(s):
(S)-3-Amino-4-phenylbutyric acid hydrochloride
CAS NO.:138165-77-2
Empirical Formula: C10H14ClNO2
Molecular Weight: 215.68
MDL number: MFCD01862875
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB220.80 | In Stock |
|
| 1G | RMB557.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 176-178 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| color | White to off-white |
| BRN | 8083915 |
| Major Application | peptide synthesis |
| InChI | 1S/C10H13NO2.ClH/c11-9(7-10(12)13)6-8-4-2-1-3-5-8;/h1-5,9H,6-7,11H2,(H,12,13);1H/t9-;/m0./s1 |
| InChIKey | MQTMGKGSJOPWJW-FVGYRXGTSA-N |
| SMILES | Cl.N[C@H](CC(O)=O)Cc1ccccc1 |
| CAS DataBase Reference | 138165-77-2(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |







