A0721356
                    1,4-Cyclohexanedicarboxylicacid , 1076-97-7
                            Synonym(s):
1,4-CHDA-HP
                            
                        
                CAS NO.:1076-97-7
Empirical Formula: C8H12O4
Molecular Weight: 172.18
MDL number: MFCD00001465
EINECS: 214-068-6
| Pack Size | Price | Stock | Quantity | 
| 500g | RMB479.20 | In Stock | 
                                                 | 
                                        
| 2.5kg | RMB3799.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 164-167 °C(lit.) | 
                                    
| Boiling point: | 262.49°C (rough estimate) | 
                                    
| Density | 1.2104 (rough estimate) | 
                                    
| refractive index | 1.4450 (estimate) | 
                                    
| Flash point: | 235°C | 
                                    
| storage temp. | Sealed in dry,Room Temperature | 
                                    
| pka | 4.38±0.10(Predicted) | 
                                    
| form | Powder | 
                                    
| color | White to off-white | 
                                    
| Water Solubility | SOLUBLE | 
                                    
| BRN | 1870377 | 
                                    
| InChI | InChI=1S/C8H12O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12) | 
                                    
| InChIKey | PXGZQGDTEZPERC-UHFFFAOYSA-N | 
                                    
| SMILES | C1(C(O)=O)CCC(C(O)=O)CC1 | 
                                    
| CAS DataBase Reference | 1076-97-7(CAS DataBase Reference) | 
                                    
| NIST Chemistry Reference | 1,4-Cyclohexanedicarboxylic acid(1076-97-7) | 
                                    
| EPA Substance Registry System | 1,4-Cyclohexanedicarboxylic acid (1076-97-7) | 
                                    
Description and Uses
                                            1,4-Cyclohexanedicarboxylic acid may be used in the synthesis of:
- polyesters
 - polyamides
 - poly(butylene adipate-co-butylene 1,4-cyclohexanedicarboxylate) copolyester
 - various polyester polyols
 
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302-H319 | 
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 | 
| Hazard Codes | Xn | 
| Risk Statements | 22-36 | 
| Safety Statements | 26-36-24/25 | 
| WGK Germany | 3 | 
| RTECS | GU9060000 | 
| TSCA | Yes | 
| HS Code | 29172090 | 



