A0721412
1-Adamantanecarbonyl chloride , 97% , 2094-72-6
CAS NO.:2094-72-6
Empirical Formula: C11H15ClO
Molecular Weight: 198.69
MDL number: MFCD00074724
EINECS: 218-252-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB25.60 | In Stock |
|
| 5G | RMB81.60 | In Stock |
|
| 25G | RMB242.40 | In Stock |
|
| 50g | RMB479.20 | In Stock |
|
| 100G | RMB754.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 49-51 °C(lit.) |
| Boiling point: | 135-136 °C10 mm Hg(lit.) |
| Density | 1.0490 (rough estimate) |
| refractive index | 1.5364 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | soluble in Toluene |
| form | Crystalline Solid |
| color | White to almost white |
| Water Solubility | may decompose |
| Sensitive | Moisture Sensitive |
| BRN | 389960 |
| InChI | 1S/C11H15ClO/c12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2/t7-,8+,9-,11- |
| InChIKey | MIBQYWIOHFTKHD-KJZNFTALSA-N |
| SMILES | ClC(=O)C12C[C@H]3C[C@H](C[C@H](C3)C1)C2 |
| CAS DataBase Reference | 2094-72-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Adamantanecarboxlic acid chloride(2094-72-6) |
Description and Uses
1-Adamantanecarbonyl chloride was used in the preparation of efficient amine-modified oligodeoxynucleotides for fabrication of DNA microarrays.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 14-34-37 |
| Safety Statements | 26-36/37/39-45-24/25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29162090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |





