A0721612
(1S,2R)-(-)-cis-1-Amino-2-indanol , 99% , 126456-43-7
Synonym(s):
(1S,2R)-(−)-cis-1-Amino-2-hydroxyindane
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB26.40 | In Stock |
|
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB67.20 | In Stock |
|
| 25G | RMB248.00 | In Stock |
|
| 100G | RMB879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-121 °C(lit.) |
| alpha | -62 º (c=0.5, CHCl3) |
| Boiling point: | 270.27°C (rough estimate) |
| Density | 1.0753 (rough estimate) |
| refractive index | 1.5760 (estimate) |
| RTECS | NK7525500 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| pka | 14.79±0.40(Predicted) |
| form | Powder |
| color | White to light beige |
| optical activity | [α]20/D 61°, c = 0.5 in chloroform |
| Water Solubility | slightly soluble |
| Sensitive | Air Sensitive |
| BRN | 4292559 |
| InChI | 1S/C9H11NO/c10-9-7-4-2-1-3-6(7)5-8(9)11/h1-4,8-9,11H,5,10H2/t8-,9+/m1/s1 |
| InChIKey | LOPKSXMQWBYUOI-BDAKNGLRSA-N |
| SMILES | N[C@@H]1[C@H](O)Cc2ccccc12 |
| CAS DataBase Reference | 126456-43-7(CAS DataBase Reference) |
Description and Uses
(1S,2R)-(-)-cis-1-Amino-2-indanol is used as a reagent in the synthesis of heterocyclic compounds as integrase inhibiting antiviral agents. It is also a key intermediate of the HIV protease inhibitor, Indinavir (I525000).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39 |
| RIDADR | 3259 |
| WGK Germany | 3 |
| F | 10-23 |
| TSCA | No |
| HazardClass | 8 |
| HS Code | 29052900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






![[1(1S,2R),5(S)]-2,3,5-Trideoxy-N-(2,3-dihydro-2-hydroxy-1H-inden-1-yl)-5-[2-[[(1,1-dimethylethyl)amino]carbonyl]-1-piperazinyl]-2-(phenylmethyl)-D-erythro-pentonamide](https://img.chemicalbook.com/CAS/GIF/150323-38-9.gif)
