A0723550
Prednisone21-acetate , 98% , 125-10-0
CAS NO.：125-10-0
Empirical Formula: C23H28O6
Molecular Weight: 400.46
MDL number: MFCD00200229
EINECS: 204-726-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB159.20 | In Stock |
|
| 1g | RMB448.00 | In Stock |
|
| 5g | RMB1295.20 | In Stock |
|
| 25g | RMB2591.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 240-242°C (dec.) |
| alpha | D25 +186° (dioxane) |
| Boiling point: | 582.0±50.0 °C(Predicted) |
| Density | 1.28±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Dioxane (Sparingly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 12.31±0.60(Predicted) |
| color | White to Off-White |
| Water Solubility | 23mg/L(25 ºC) |
| InChIKey | MOVRKLZUVNCBIP-RFZYENFJSA-N |
| SMILES | C1(=O)C=C2[C@](C)(C=C1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](CC1=O)(C)[C@@](O)(C(=O)COC(C)=O)CC3)CC2 |
| CAS DataBase Reference | 125-10-0(CAS DataBase Reference) |
Description and Uses
Adrenocortical steroid antiinflammatory.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Warning |
| Hazard statements | H361-H373 |
| Precautionary statements | P201-P202-P281-P308+P313-P405-P501-P260-P314-P501 |
