A0725512
L-Aspartic acid di-tert-butyl ester hydrochloride , 98% , 1791-13-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB67.20 | In Stock |
|
| 25G | RMB236.80 | In Stock |
|
| 100g | RMB783.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 152-155 °C |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | soluble in Methanol |
| form | Solid |
| color | White to Almost white |
| optical activity | 10.6596°(C=1.0045g/100ml ETOH) |
| BRN | 5652807 |
| InChI | 1S/C12H23NO4.ClH/c1-11(2,3)16-9(14)7-8(13)10(15)17-12(4,5)6;/h8H,7,13H2,1-6H3;1H/t8-;/m0./s1 |
| InChIKey | GVLZIMQSYQDAHB-QRPNPIFTSA-N |
| SMILES | Cl.CC(C)(C)OC(=O)C[C@H](N)C(=O)OC(C)(C)C |
| CAS DataBase Reference | 1791-13-5 |
Description and Uses
L-Aspartic acid di-tert-butyl ester hydrochloride may be used in neurological comparison studies with structurally similar compounds such as L-Glutamic acid di-tert-butyl ester.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29224999 |
| Storage Class | 13 - Non Combustible Solids |







