A0729256
BenoxacorSolutioninMethanol , 1000 μg/mlinmethanol, uncertainty 2%
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105-107° |
| Boiling point: | 240°C (rough estimate) |
| Density | 1.3416 (rough estimate) |
| vapor pressure | 0.002Pa at 25℃ |
| refractive index | 1.6070 (estimate) |
| Flash point: | >107 °C |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 1.20±0.40(Predicted) |
| color | Pale Brown to Light Brown |
| Water Solubility | 38mg/L at 25℃ |
| BRN | 4190275 |
| Major Application | agriculture environmental |
| InChI | 1S/C11H11Cl2NO2/c1-7-6-16-9-5-3-2-4-8(9)14(7)11(15)10(12)13/h2-5,7,10H,6H2,1H3 |
| InChIKey | PFJJMJDEVDLPNE-UHFFFAOYSA-N |
| SMILES | CC1COc2ccccc2N1C(=O)C(Cl)Cl |
| LogP | 2.6 at 25℃ |
| CAS DataBase Reference | 98730-04-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benoxacor(98730-04-2) |
| EPA Substance Registry System | Benoxacor (98730-04-2) |
Description and Uses
Benoxacor is a herbicide used as a part of pesticidal compositions.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H410 |
| Precautionary statements | P261-P272-P273-P280-P302+P352-P333+P313 |
| PPE | Eyeshields, Faceshields, Gloves, type N95 (US) |
| WGK Germany | 2 |
| RTECS | DM3029000 |
| TSCA | TSCA listed |
| HS Code | 29349990 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Aquatic Chronic 1 Skin Sens. 1 |
| Toxicity | LD50 (mg/kg): >5000 orally in rats; >2010 dermally in rabbits; LC50 in rats (mg/l): >2000 by inhalation (Fed. Regist.) |




