A0733312
(1R,2S)-(-)-2-Amino-1,2-diphenylethanol , 99% , 23190-16-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB77.60 | In Stock |
|
| 25G | RMB299.20 | In Stock |
|
| 100G | RMB967.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 142-144 °C(lit.) |
| alpha | -7 º (c=0.6, EtOH) |
| Boiling point: | 374.3±37.0 °C(Predicted) |
| Density | 1.148±0.06 g/cm3(Predicted) |
| refractive index | -7 ° (C=0.6, EtOH) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Ethanol, Methanol |
| pka | 11.70±0.45(Predicted) |
| form | Powder |
| color | white to light-yellow |
| optical activity | [α]25/D 7.0°, c = 0.6 in ethanol |
| BRN | 2806218 |
| InChI | InChI=1/C14H15NO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14,16H,15H2/t13-,14+/s3 |
| InChIKey | GEJJWYZZKKKSEV-JJANDPSINA-N |
| SMILES | [C@@H](C1C=CC=CC=1)(N)[C@@H](C1C=CC=CC=1)O |&1:0,8,r| |
| CAS DataBase Reference | 23190-16-1(CAS DataBase Reference) |
Description and Uses
Chiral auxiliary used for Pd(II)-assisted chiral tandem alkylation and carbonylative coupling reactions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29221990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




