A0735656
9-(2-bromophenyl)carbazole , >99% , 902518-11-0
CAS NO.:902518-11-0
Empirical Formula: C18H12BrN
Molecular Weight: 322.2
MDL number: MFCD23135883
EINECS: 694-393-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB63.20 | In Stock |
|
| 5g | RMB199.20 | In Stock |
|
| 25g | RMB639.20 | In Stock |
|
| 100g | RMB1871.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93-94℃ |
| Boiling point: | 462.0±37.0 °C(Predicted) |
| Density | 1.39±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C18H12BrN/c19-15-9-3-6-12-18(15)20-16-10-4-1-7-13(16)14-8-2-5-11-17(14)20/h1-12H |
| InChIKey | KEWDVYIULXXMPP-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=CC=C2Br)C2=C(C=CC=C2)C2=C1C=CC=C2 |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| HS Code | 2933.99.8290 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |






