A0737012
3-Amino-2-bromo-5-fluoropyridine , 97% , 884495-03-8
Synonym(s):
2-Bromo-5-fluoro-3-pyridinamine;2-Bromo-5-fluoro-pyridin-3-amine
CAS NO.:884495-03-8
Empirical Formula: C5H4BrFN2
Molecular Weight: 191
MDL number: MFCD05662413
EINECS: 629-495-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB53.60 | In Stock |
|
| 1G | RMB154.40 | In Stock |
|
| 5G | RMB488.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 114-116 °C |
| Boiling point: | 273.6±35.0 °C(Predicted) |
| Density | 1.813±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | solid |
| pka | -0.50±0.10(Predicted) |
| color | White to off-white |
| InChI | InChI=1S/C5H4BrFN2/c6-5-4(8)1-3(7)2-9-5/h1-2H,8H2 |
| InChIKey | QUZAKZBKMMUARE-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=C(F)C=C1N |
Description and Uses
3-Amino-2-bromo-5-fluoropyridine is a polyhalogenated pyridine with the chemical formula C5H4BrFN2. The compound has three functional groups: amino, bromine and fluorine, which change its reactivity. It is a crucial compound that could be used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P301+P312+P330-P305+P351+P338+P310 |
| Hazard Codes | Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| HS Code | 2933399990 |






