A0739612
5-Amino-3-bromo-2-chloropyridine , 97% , 130284-53-6
Synonym(s):
3-Amino-5-bromo-6-chloropyridine;5-Bromo-6-chloro-3-pyridinamine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB74.40 | In Stock |
|
| 25G | RMB232.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120-122°C |
| Boiling point: | 336.7±37.0 °C(Predicted) |
| Density | 1.834±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| form | powder to crystal |
| pka | 0.86±0.10(Predicted) |
| color | Light yellow to Brown |
| InChI | InChI=1S/C5H4BrClN2/c6-4-1-3(8)2-9-5(4)7/h1-2H,8H2 |
| InChIKey | ISKBXMMELYRESC-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=C(Br)C=C1N |
| CAS DataBase Reference | 130284-53-6(CAS DataBase Reference) |
Description and Uses
5-Bromo-6-chloropyridin-3-amine serves as a precursor for synthesizing 3-bromo-2-chloro-5-iodopyridine via diazotization followed by iodination [4].
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H318 |
| Precautionary statements | P280-P301+P310+P330-P305+P351+P338+P310 |
| Hazard Codes | Xi,T |
| Risk Statements | 25-41 |
| Safety Statements | 26-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |





