A0740856
FomesafenSolutioninAcetonitrile , 1000 μg/mlinaCetonitrile, uncertainty 2%
Synonym(s):
5-[2-Chloro-4-(trifluoromethyl)phenoxy]-N-(methylsulfonyl)-2-nitrobenzamide
CAS NO.:
Empirical Formula: C15H10ClF3N2O6S
Molecular Weight: 438.76
MDL number: MFCD01632756
EINECS: 276-439-9
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220-221°C |
| Density | 1.7075 (rough estimate) |
| refractive index | 1.5660 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Acetonitrile (Slightly), DMSO |
| form | Solid |
| pka | 23-25(at 25℃) |
| color | White to Off-White |
| BRN | 8165046 |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C15H10ClF3N2O6S/c1-28(25,26)20-14(22)10-7-9(3-4-12(10)21(23)24)27-13-5-2-8(6-11(13)16)15(17,18)19/h2-7H,1H3,(H,20,22) |
| InChIKey | BGZZWXTVIYUUEY-UHFFFAOYSA-N |
| SMILES | C(NS(C)(=O)=O)(=O)C1=CC(OC2=CC=C(C(F)(F)F)C=C2Cl)=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 72178-02-0(CAS DataBase Reference) |
| EPA Substance Registry System | Fomesafen (72178-02-0) |
Description and Uses
Fomesafen is a protoporphyrinogen oxidae (PPO) inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 2 |
| WGK Germany | 1 |
| RTECS | CV2475000 |
| HS Code | 29350090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 72178-02-0(Hazardous Substances Data) |
| Toxicity | LD50 orally in male, female rats (mg/kg): 1250-2000, 1600; LC50 (48, 96 hr.) in rainbow trout and bluegill (mg/l): 830, 680, 6740, 6030 (Colby) |




