A0741112
Ancymidol , Plant cell culture level, ≥98.0%(HPLC) , 12771-68-5
Synonym(s):
α-Cyclopropyl-α-(4-methoxyphenyl)-5-pyrimidinemethanol;reducymol;thritone
CAS NO.:12771-68-5
Empirical Formula: C15H16N2O2
Molecular Weight: 256.3
MDL number: MFCD00072501
EINECS: 235-814-7
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB366.40 | In Stock |
|
| 100MG | RMB1111.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110-111°C |
| Boiling point: | 399.55°C (rough estimate) |
| Density | 1.1055 (rough estimate) |
| refractive index | 1.6280 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 12.62±0.29(Predicted) |
| color | White to Off-White |
| Water Solubility | 0.65g/L(25 ºC) |
| λmax | 272nm(lit.) |
| Major Application | agriculture |
| InChI | InChI=1S/C15H16N2O2/c1-19-14-6-4-12(5-7-14)15(18,11-2-3-11)13-8-16-10-17-9-13/h4-11,18H,2-3H2,1H3 |
| InChIKey | HUTDUHSNJYTCAR-UHFFFAOYSA-N |
| SMILES | C(O)(C1C=NC=NC=1)(C1C=CC(OC)=CC=1)C1CC1 |
| CAS DataBase Reference | 12771-68-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Ancymidol(12771-68-5) |
| EPA Substance Registry System | Ancymidol (12771-68-5) |
Description and Uses
Ancymidol has been used as the cytochrome P450 inhibitor to study its effects on Cyanidioschyzon merolae?strain.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | UV9280000 |
| HS Code | 2933599590 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 in rats, mice (mg/kg): 4500, 5000 orally (Snel, Gramlich) |





