A0741712
4-Amino-2-fluorobenzoic acid , 98% , 446-31-1
CAS NO.:446-31-1
Empirical Formula: C7H6FNO2
Molecular Weight: 155.13
MDL number: MFCD01569397
EINECS: 207-163-9
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB58.40 | In Stock |
|
| 25G | RMB250.40 | In Stock |
|
| 100G | RMB716.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210 °C (dec.) |
| Boiling point: | 336.1±27.0 °C(Predicted) |
| Density | 1.430±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | 3.93±0.10(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C7H6FNO2/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3H,9H2,(H,10,11) |
| InChIKey | QHERSCUZBKDVOC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(N)C=C1F |
| CAS DataBase Reference | 446-31-1(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2922498590 |








