A0742612
2-Amino-3-bromo-6-methylpyridine , 98% , 126325-46-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB36.80 | In Stock |
|
| 5G | RMB232.80 | In Stock |
|
| 25g | RMB1167.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77-79°C |
| Boiling point: | 238.5±35.0 °C(Predicted) |
| Density | 1.5672 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| form | Solid |
| pka | 4.24±0.50(Predicted) |
| color | Off-white |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C6H7BrN2/c1-4-2-3-5(7)6(8)9-4/h2-3H,1H3,(H2,8,9) |
| InChIKey | JYWWGZAAXTYNRN-UHFFFAOYSA-N |
| SMILES | C1(N)=NC(C)=CC=C1Br |
| CAS DataBase Reference | 126325-46-0(CAS DataBase Reference) |
Description and Uses
2-Amino-3-bromo-6-methylpyridine is a versatile chemical compound that plays a significant role in various fields, particularly in pharmaceuticals and agrochemicals.
2-Amino-3-bromo-6-methylpyridine is recognized for its unique structure, which allows it to act as a key intermediate in the synthesis of biologically active molecules. Its bromine and amino functional groups enhance its reactivity, making it an essential building block for the development of new drugs and crop protection agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36 |
| HazardClass | 6.1 |
| HS Code | 29333999 |
