A0747656
2-Chloro-4-methylquinolin , 97% , 634-47-9
Synonym(s):
2-Chloro-4-methylquinoline;2-Chlorolepidine
CAS NO.:634-47-9
Empirical Formula: C10H8ClN
Molecular Weight: 177.63
MDL number: MFCD00006742
EINECS: 211-209-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB68.80 | In Stock |
|
| 25g | RMB271.20 | In Stock |
|
| 100g | RMB871.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55-58 °C(lit.) |
| Boiling point: | 296 °C(lit.) |
| Density | 1.1810 (rough estimate) |
| refractive index | 1.6224 (estimate) |
| Flash point: | 296°C |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 0.98±0.50(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 118333 |
| InChI | InChI=1S/C10H8ClN/c1-7-6-10(11)12-9-5-3-2-4-8(7)9/h2-6H,1H3 |
| InChIKey | PFEIMKNQOIFKSW-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C(C)=CC=1Cl |
| CAS DataBase Reference | 634-47-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Quinoline, 2-chloro-4-methyl-(634-47-9) |
Description and Uses
2-Chloro-4-methyl-quinoline is a useful synthetic intermediate. It is an intermediate used to synthesize 4-Methyl-2-(1-piperidinyl)-quinoline (M320715) which is a potent inhibitor of TRPC4 channels, responsible for various stimulation, muscle response due to interaction with the environment. 2-Chloro-4-methyl-quinoline is also considered as a cyanine dye.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36-24/25 |
| WGK Germany | 3 |
| HS Code | 29334900 |







