A0749612
3-Amino-5-hydroxypyrazole , 98% , 6126-22-3
CAS NO.:6126-22-3
Empirical Formula: C3H5N3O
Molecular Weight: 99.09
MDL number: MFCD00022384
EINECS: 228-095-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB65.60 | In Stock |
|
| 25G | RMB236.00 | In Stock |
|
| 100G | RMB861.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 214 °C (dec.) (lit.) |
| Boiling point: | 185.55°C (rough estimate) |
| Density | 1.3131 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) |
| form | Crystalline Powder |
| pka | 12.37±0.40(Predicted) |
| color | Yellow-beige to beige-brown |
| BRN | 507793 |
| InChI | InChI=1S/C3H5N3O/c4-2-1-3(7)6-5-2/h1H2,(H2,4,5)(H,6,7) |
| InChIKey | QZBGOTVBHYKUDS-UHFFFAOYSA-N |
| SMILES | N1=C(N)CC(=O)N1 |
| CAS DataBase Reference | 6126-22-3(CAS DataBase Reference) |
Description and Uses
Amino-substituted heterocyclic compound with moderate alanine racemase inhibitory activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29331990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



