A0754412
2-Amino-6-fluorobenzonitrile , 99% , 77326-36-4
Synonym(s):
6-Fluoroanthranilonitrile
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB64.80 | In Stock |
|
| 100G | RMB235.20 | In Stock |
|
| 500g | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125-128 °C (lit.) |
| Boiling point: | 275.8±25.0 °C(Predicted) |
| Density | 1.25±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform |
| form | Solid |
| pka | 0.80±0.10(Predicted) |
| color | Pale Yellow |
| BRN | 3588945 |
| InChI | InChI=1S/C7H5FN2/c8-6-2-1-3-7(10)5(6)4-9/h1-3H,10H2 |
| InChIKey | IQUNZGOZUJITBJ-UHFFFAOYSA-N |
| SMILES | C(#N)C1=C(F)C=CC=C1N |
| CAS DataBase Reference | 77326-36-4(CAS DataBase Reference) |
Description and Uses
2-Amino-6-fluorobenzonitrile, a medicinal chemistry intermediate, has been employed for the preparation of tacrine-related compounds. It may be used for the synthesis of antifolate and antibacterial quinazoline derivatives.
It may be used for the synthesis bis(4-oxoquinazolin-2-yl)pyridine and fluoro-containing quinazolin-4(1H)-ones. It may be employed for the synthesis of the following novel huprines:
- 12-amino-3-chloro-6,7,10,11-tetrahydro-9-isopropyl-7,11-methanocycloocta[b]quinoline hydrochloride
- 9-allyl-12-amino-3-chloro-6,7,10,11-tetrahydro-7,11-methanocycloocta[b]quinoline hydrochloride
- 12-amino-1-fluoro-6,7,10,11-tetrahydro-9-isopropyl-7,11-methanocycloocta[b]quinoline hydrochloride
- 9-allyl-12-amino-1-fluoro-6,7,10,11-tetrahydro-7,11-methanocycloocta[b]quinoline hydrochloride
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xi,T,Xn |
| Risk Statements | 36-36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39-22 |
| RIDADR | 3439 |
| WGK Germany | 2 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
