A0755812
Adenosine 3',5'-Cyclic Monophosphate Sodium Salt Hydrate , 99% , 37839-81-9
Synonym(s):
3′,5′-Cyclic AMP sodium salt;cAMP-Na
CAS NO.:37839-81-9
Empirical Formula: C10H13N5NaO6P
Molecular Weight: 353.21
MDL number: MFCD00069736
EINECS: 253-328-3
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB95.20 | In Stock |
|
| 100MG | RMB239.20 | In Stock |
|
| 500MG | RMB927.20 | In Stock |
|
| 2.5G | RMB3599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| solubility | H2O: 50 mg/mL |
| form | powder |
| color | white |
| Water Solubility | Soluble in water (50 mg/ml). |
| BRN | 54612 |
| Stability: | Hygroscopic |
| InChI | 1S/C10H12N5O6P.Na/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(16)7-4(20-10)1-19-22(17,18)21-7;/h2-4,6-7,10,16H,1H2,(H,17,18)(H2,11,12,13);/q;+1/p-1/t4-,6-,7-,10-;/m1./s1 |
| InChIKey | BXJBFCKTIWRKMQ-MCDZGGTQSA-M |
| SMILES | [Na+].Nc1ncnc2n(cnc12)[C@@H]3O[C@@H]4COP([O-])(=O)O[C@H]4[C@H]3O |
| CAS DataBase Reference | 37839-81-9 |
Description and Uses
Adenosine 3?,5?-cyclic monophosphate sodium salt monohydrate is used as an activator of protein kinase A (PKA) . A key regulator of many cellular reactions. Released in response to hormonal stimulation. . Directly activates Epac, a Rap1 guanine-nucleotide exchange factor. Acts as a second messenger in signal transduction mechanisms. Promotes apoptosis in resting human B lymphocytes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 2 |
| RTECS | AU7357900 |
| F | 10-21 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |





