A0756912
4-Amino-2-chloropyrimidine-5-carbonitrile , 97% , 94741-69-2
| Pack Size | Price | Stock | Quantity |
| 500MG | RMB124.00 | In Stock |
|
| 1G | RMB154.40 | In Stock |
|
| 5G | RMB584.00 | In Stock |
|
| 25g | RMB2431.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200 °C (dec.) (lit.) |
| Boiling point: | 435.0±30.0 °C(Predicted) |
| Density | 1.53±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| solubility | DMF, DMSO, Methanol, Water |
| pka | -0.68±0.10(Predicted) |
| form | Powder or Flakes |
| color | Brown |
| InChI | InChI=1S/C5H3ClN4/c6-5-9-2-3(1-7)4(8)10-5/h2H,(H2,8,9,10) |
| InChIKey | WDHFCSOENXEMRC-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(C#N)C(N)=N1 |
| CAS DataBase Reference | 94741-69-2(CAS DataBase Reference) |
Description and Uses
4-Amino-2-chloropyrimidine-5-carbonitrile is a potential substituent in the synthesis of anti-anxiety, anti-depressant and anti-psychotic agents.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H317-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41-43 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN3439 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29335990 |
