A0757212
4-Amino-1-methylpiperidine , >97.0%(GC) , 41838-46-4
CAS NO.:41838-46-4
Empirical Formula: C6H14N2
Molecular Weight: 114.19
MDL number: MFCD03426069
EINECS: 628-217-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB55.20 | In Stock |
|
| 25G | RMB199.20 | In Stock |
|
| 100G | RMB735.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 203-207 |
| Boiling point: | 62-64°C 1mm |
| Density | 0.91 |
| refractive index | 1.4700-1.4740 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 9.92±0.20(Predicted) |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C6H14N2/c1-8-4-2-6(7)3-5-8/h6H,2-5,7H2,1H3 |
| InChIKey | ALOCUZOKRULSAA-UHFFFAOYSA-N |
| SMILES | N1(C)CCC(N)CC1 |
| CAS DataBase Reference | 41838-46-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H226-H314 |
| Precautionary statements | P210-P233-P240-P241+P242+P243-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P370+P378-P403+P235-P405-P501 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22-34-11 |
| Safety Statements | 26-36/37/39-45-22-16-9 |
| RIDADR | 2920 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅱ |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |






