A0757712
Allyl oxalyl chloride , 97% , 74503-07-4
Synonym(s):
2-Propen-1-yloxy chloroacetate;Allyl 2-chloro-2-oxoacetate;Chlorooxoacetic acid 2-propenyl ester
CAS NO.:74503-07-4
Empirical Formula: C5H5ClO3
Molecular Weight: 148.54
MDL number: MFCD08274650
EINECS: 277-900-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB91.20 | In Stock |
|
| 5G | RMB311.20 | In Stock |
|
| 25G | RMB935.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 50-51 °C(Press: 12 Torr) |
| Density | 1.213g/mLat 25℃ |
| refractive index | n20/D 1.443 |
| Flash point: | 56°C |
| form | liquid |
| InChI | InChI=1S/C5H5ClO3/c1-2-3-9-5(8)4(6)7/h2H,1,3H2 |
| InChIKey | HNOLIWBAJVIBOU-UHFFFAOYSA-N |
| SMILES | C(OCC=C)(=O)C(Cl)=O |
Description and Uses
Allyl chlorooxoacetate is a pharmaceutical intermediate compound for the preparation of Sulopenem, which is an orally active parenteral penem antibiotic used for the treatment of urinary tract infections and intra-abdominal infections caused by multi-drug resistance.
Allyl Oxalyl Chloride can be prepared to be used as pesticides and fungicides.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H302-H314 |
| Precautionary statements | P210-P233-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2920 3(8) / PGII |
| WGK Germany | 3 |





