A0758012
2-Amino-4-bromopyridine , 98% , 84249-14-9
CAS NO.：84249-14-9
Empirical Formula: C5H5BrN2
Molecular Weight: 173.01
MDL number: MFCD01646115
EINECS: 640-931-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB33.60 | In Stock |
|
| 5G | RMB77.60 | In Stock |
|
| 25G | RMB319.20 | In Stock |
|
| 100G | RMB1161.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 142-146 °C |
| Boiling point: | 268.2±20.0 °C(Predicted) |
| Density | 1.710±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 5.72±0.11(Predicted) |
| form | Solid |
| color | Off-White to Beige |
| InChI | InChI=1S/C5H5BrN2/c6-4-1-2-8-5(7)3-4/h1-3H,(H2,7,8) |
| InChIKey | BAQKUNMKVAPWGU-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=CC(Br)=C1 |
| CAS DataBase Reference | 84249-14-9(CAS DataBase Reference) |
Description and Uses
2-Amino-4-bromopyridine is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-36-22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
