A0758112
2-Amino-5-bromopyrimidine , >98.0% , 7752-82-1
CAS NO.:7752-82-1
Empirical Formula: C4H4BrN3
Molecular Weight: 174
MDL number: MFCD00012341
EINECS: 629-581-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB57.60 | In Stock |
|
| 100G | RMB207.20 | In Stock |
|
| 500g | RMB836.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 241-243 °C (lit.) |
| Boiling point: | 340.7±34.0 °C(Predicted) |
| Density | 1.844±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 1.93±0.10(Predicted) |
| form | Crystalline Powder, Crystals or Flakes |
| color | White to light beige |
| Water Solubility | Insoluble |
| InChI | InChI=1S/C4H4BrN3/c5-3-1-7-4(6)8-2-3/h1-2H,(H2,6,7,8) |
| InChIKey | UHRHPPKWXSNZLR-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C(Br)C=N1 |
| CAS DataBase Reference | 7752-82-1(CAS DataBase Reference) |
Description and Uses
2-Amino-5-bromopyrimidine was employed:
- in synthesis of pyridine, pyrimidine and pyridinone C-nucleoside phosphoramidites
- in synthesis of 2-phthalimido-5-bromopyrimidine
- as intermediate for the preparation of sulfanilamides and amino acids containing the pyrimidine ring system. The products are potential antiviral agents
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H319-H400 |
| Precautionary statements | P264-P270-P273-P280-P301+P312-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,N,Xi |
| Risk Statements | 22-36-50/53 |
| Safety Statements | 26-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT, IRRITANT-HARMFUL |
| PackingGroup | III |
| HS Code | 29335995 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Irrit. 2 |





