A0759412
2-Amino-4,6-dihydroxypyrimidine , 98% , 56-09-7
Synonym(s):
2-Amino-4,6-pyrimidinediol
CAS NO.:56-09-7
Empirical Formula: C4H5N3O2
Molecular Weight: 127.1
MDL number: MFCD00006094
EINECS: 200-256-5
| Pack Size | Price | Stock | Quantity |
| 25G | RMB40.80 | In Stock |
|
| 100G | RMB97.60 | In Stock |
|
| 250G | RMB211.20 | In Stock |
|
| 500G | RMB330.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (lit.) |
| Boiling point: | 235.85°C (rough estimate) |
| Density | 1.4748 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Soluble in Aqueous Alkali. |
| pka | 7.45±0.10(Predicted) |
| form | Powder |
| color | Off-white to light pink or light yellow |
| BRN | 510297 |
| InChI | InChI=1S/C4H5N3O2/c5-4-6-2(8)1-3(9)7-4/h1H,(H4,5,6,7,8,9) |
| InChIKey | AUFJTVGCSJNQIF-UHFFFAOYSA-N |
| SMILES | C1(N)=NC(O)=CC(=O)N1 |
| CAS DataBase Reference | 56-09-7(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Amino-6-hydroxy-4(1H)-pyrimidinone (56-09-7) |
Description and Uses
2-Amino-4,6-dihydroxypyrimidine is a hydroxypyrimidine.
2-Amino-4,6-dihydroxypyrimidine acts as an intermediate in the production of antimicrobial guanylsulfonamides. It also acts as an intermediate in pharmaceuticals and agrochemicals.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 1 |
| RTECS | UW7361000 |
| TSCA | TSCA listed |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |






