PRODUCT Properties
| Boiling point: | 39 °C |
| Density | 1.42 |
| refractive index | 1.4960-1.4990 |
| Flash point: | 39-40°C/0.1mm |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | clear liquid |
| pka | -0.48±0.10(Predicted) |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C7H5ClF3N/c8-5-3-1-2-4(6(5)12)7(9,10)11/h1-3H,12H2 |
| InChIKey | OTRRSPQJZRCMDA-UHFFFAOYSA-N |
| SMILES | C1(N)=C(C(F)(F)F)C=CC=C1Cl |
| CAS DataBase Reference | 433-94-3(CAS DataBase Reference) |
Description and Uses
2-Chloro-6-(trifluoromethyl)aniline is a molecular determinant for the selective inhibition of cyclooxygenase-2 by lumiracoxib.
Safety
| Symbol(GHS) |   GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H302-H312-H331-H227-H302+H312+H332-H315-H319 |
| Precautionary statements | P210-P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P403+P235-P501-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-65 |
| Safety Statements | 26-36/37/39-36 |
| RIDADR | UN2810 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2921490090 |
