A0760212
2-Amino-5-methoxybenzoic acid , 98% , 6705-03-9
Synonym(s):
6-Amino-m-anisic acid
| Pack Size | Price | Stock | Quantity |
| 1G | RMB37.60 | In Stock |
|
| 5G | RMB112.80 | In Stock |
|
| 25G | RMB446.40 | In Stock |
|
| 100g | RMB1323.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148-152 °C |
| Boiling point: | 349.9±27.0 °C(Predicted) |
| Density | 1.303±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Methanol (Slightly) |
| pka | 2.08±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to yellow to pale orange |
| BRN | 777690 |
| InChI | InChI=1S/C8H9NO3/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,9H2,1H3,(H,10,11) |
| InChIKey | UMKSAURFQFUULT-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(OC)=CC=C1N |
| CAS DataBase Reference | 6705-03-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Methoxyanthranilic acid(6705-03-9) |
Description and Uses
2-Amino-5-methoxybenzoic acid is a general reagent used in the synthesis of substituted isoquinolinonaphthyridines, quinazolinones, imidazobenzodiazepines, pyridoquinazolones and polycyclic hexahydrobenzo[c]acridines.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-36-37 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29225090 |
