A0760712
3-Amino-2,6-dichloropyridine , 98% , 62476-56-6
Synonym(s):
2,6-Dichloro-3-pyridinamine
CAS NO.:62476-56-6
Empirical Formula: C5H4Cl2N2
Molecular Weight: 163
MDL number: MFCD00023417
EINECS: 263-559-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB91.20 | In Stock |
|
| 25G | RMB290.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 122 °C |
| Boiling point: | 268.76°C (rough estimate) |
| Density | 1.5462 (rough estimate) |
| refractive index | 1.6300 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -0.01±0.10(Predicted) |
| color | White to Gray to Brown |
| InChI | InChI=1S/C5H4Cl2N2/c6-4-2-1-3(8)5(7)9-4/h1-2H,8H2 |
| InChIKey | MJVZSRZTBDMYLX-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=CC=C1N |
| CAS DataBase Reference | 62476-56-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Amino-2,6-dichloropyridine(62476-56-6) |
Description and Uses
2,6-Dichloro-3-pyridinamine is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H317-H318 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-43-41-22 |
| Safety Statements | 26-36/37/39-37/39-36-28 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29333990 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Sens. 1 |







