A0760812
4-Amino-2-chlorobenzoic acid , 98% , 2457-76-3
CAS NO.:2457-76-3
Empirical Formula: C7H6ClNO2
Molecular Weight: 171.58
MDL number: MFCD03407960
EINECS: 219-540-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB37.60 | In Stock |
|
| 25G | RMB147.20 | In Stock |
|
| 100G | RMB559.20 | In Stock |
|
| 500g | RMB2720.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 211 °C (dec.) (lit.) |
| Boiling point: | 250°C (rough estimate) |
| Density | 1.3246 (rough estimate) |
| refractive index | 1.5560 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 3.81±0.25(Predicted) |
| form | Powder |
| color | Beige to light brown |
| BRN | 2803668 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H6ClNO2/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3H,9H2,(H,10,11) |
| InChIKey | MBDUKNCPOPMRJQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(N)C=C1Cl |
| CAS DataBase Reference | 2457-76-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 4-amino-2-chloro-(2457-76-3) |
| EPA Substance Registry System | Benzoic acid, 4-amino-2-chloro- (2457-76-3) |
Description and Uses
4-Amino-2-chlorobenzoic acid is the principal metabolite of 2-Chloroprocaine, a compound that is widely used for epidural analgesia in obstetrics.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | DG1575000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29224995 |
| Storage Class | 11 - Combustible Solids |






