PRODUCT Properties
| Melting point: | 159-162 °C (lit.) |
| Boiling point: | 349.8±32.0 °C(Predicted) |
| Density | 1.41±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in ethanol and benzene. |
| form | Powder, Crystals or Crystalline Powder |
| pka | -3.52±0.10(Predicted) |
| color | Yellow |
| BRN | 778939 |
| InChI | InChI=1S/C7H5N3O2/c8-4-5-1-2-6(9)7(3-5)10(11)12/h1-3H,9H2 |
| InChIKey | JAHADAZIDZMHOP-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(N)C([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 6393-40-4(CAS DataBase Reference) |
Description and Uses
4-Amino-3-nitrobenzonitrile is used in gamma irradiations effect on release of this compound from polyanhydride matrixes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
