A0763012
5-Amino-4-imidazolecarboxamide hydrochloride , 98% , 72-40-2
Synonym(s):
4-Amino-5-imidazolecarboxamide hydrochloride;5-Amino-4-imidazolecarboxamide hydrochloride;5-aminoimidazole-4-carboxamide hydrochloride;AICA
CAS NO.:72-40-2
Empirical Formula: C4H7ClN4O
Molecular Weight: 162.58
MDL number: MFCD00012704
EINECS: 200-778-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB59.20 | In Stock |
|
| 25G | RMB138.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 250-252 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| solubility | water: soluble50mg/mL, clear, light yellow |
| form | Crystals or Crystalline Powder |
| color | White |
| Water Solubility | SOLUBLE |
| Sensitive | Hygroscopic |
| BRN | 3701645 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C4H6N4O.ClH/c5-3-2(4(6)9)7-1-8-3;/h1H,5H2,(H2,6,9)(H,7,8);1H |
| InChIKey | MXCUYSMIELHIQL-UHFFFAOYSA-N |
| SMILES | C1(N=CNC=1N)C(=O)N.Cl |
| CAS DataBase Reference | 72-40-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Imidazole-4(5)-carboxamide, 5-(4)-amino-, hydrochloride(72-40-2) |
| EPA Substance Registry System | 1H-Imidazole-4-carboxamide, 5-amino-, monohydrochloride (72-40-2) |
Description and Uses
5-Amino-4-imidazolecarboxamide hydrochloride was used in the synthesis of heterocyclic compounds such as guanine, purines and pyrimidines.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| RTECS | NI3911000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29332990 |
| Storage Class | 11 - Combustible Solids |






