A0766812
(+)-Anabasine hydrochloride , 96% , 53912-89-3
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB2911.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220-222 °C |
| Flash point: | 9℃ |
| storage temp. | Desiccate at RT |
| form | Powder |
| Water Solubility | Soluble to 100 mM in water |
| Major Application | forensics and toxicology |
| InChI | 1S/C10H14N2.ClH/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;/h1,3,5,7,10,12H,2,4,6,8H2;1H/t10-;/m0./s1 |
| InChIKey | MFJBWMJZAOKGHG-PPHPATTJSA-N |
| SMILES | [H]Cl.[C@@H]1(C2=CC=CN=C2)CCCCN1 |
Description and Uses
(+)-Anabasine Hydrochloride is a hydrochloride analog of (S)-Anabasine (A637170), which is a nicotinic receptor agonist.
Safety
| Symbol(GHS) |    GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P260-P280-P301+P310-P311 |
| target organs | Eyes |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| HS Code | 2933399990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
