A0767012
1-(4-Aminophenyl)-4-(4-methoxyphenyl)piperazine , 96% , 74852-62-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB108.80 | In Stock |
|
| 5G | RMB447.20 | In Stock |
|
| 25G | RMB1406.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 186 °C |
| Boiling point: | 506.7±50.0 °C(Predicted) |
| Density | 1.165±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Dichloromethane (Slightly) |
| form | Solid |
| pka | 7.69±0.10(Predicted) |
| color | Dark Purple to Dark Grey |
| InChI | InChI=1S/C17H21N3O/c1-21-17-8-6-16(7-9-17)20-12-10-19(11-13-20)15-4-2-14(18)3-5-15/h2-9H,10-13,18H2,1H3 |
| InChIKey | VXEGSRKPIUDPQT-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(N2CCN(C3=CC=C(OC)C=C3)CC2)C=C1 |
| CAS DataBase Reference | 74852-62-3(CAS DataBase Reference) |
Description and Uses
4-[4-(4-Methyloxy-phenyl)-piperazin-1-yl]-phenylamine, is an intermediate for the synthesis of Itraconazole (I937500), an Antifungal.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| HS Code | 2933599590 |






![4-([4-(4-METHYLOXY-PHENYL)-PIPERAZIN-1-YL]-PHENYL)-CARBAMIC ACID PHENYL ESTER](https://img.chemicalbook.com/CAS/GIF/74853-06-8.gif)