A0767012
                    1-(4-Aminophenyl)-4-(4-methoxyphenyl)piperazine , 96% , 74852-62-3
| Pack Size | Price | Stock | Quantity | 
| 1G | RMB108.80 | In Stock | 
                                                 | 
                                        
| 5G | RMB447.20 | In Stock | 
                                                 | 
                                        
| 25G | RMB1406.40 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 186 °C | 
                                    
| Boiling point: | 506.7±50.0 °C(Predicted) | 
                                    
| Density | 1.165±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature | 
                                    
| solubility | Chloroform (Slightly), Dichloromethane (Slightly) | 
                                    
| form | Solid | 
                                    
| pka | 7.69±0.10(Predicted) | 
                                    
| color | Dark Purple to Dark Grey | 
                                    
| InChI | InChI=1S/C17H21N3O/c1-21-17-8-6-16(7-9-17)20-12-10-19(11-13-20)15-4-2-14(18)3-5-15/h2-9H,10-13,18H2,1H3 | 
                                    
| InChIKey | VXEGSRKPIUDPQT-UHFFFAOYSA-N | 
                                    
| SMILES | C1(N)=CC=C(N2CCN(C3=CC=C(OC)C=C3)CC2)C=C1 | 
                                    
| CAS DataBase Reference | 74852-62-3(CAS DataBase Reference) | 
                                    
Description and Uses
4-[4-(4-Methyloxy-phenyl)-piperazin-1-yl]-phenylamine, is an intermediate for the synthesis of Itraconazole (I937500), an Antifungal.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319 | 
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 | 
| HS Code | 2933599590 | 






![4-([4-(4-METHYLOXY-PHENYL)-PIPERAZIN-1-YL]-PHENYL)-CARBAMIC ACID PHENYL ESTER](https://img.chemicalbook.com/CAS/GIF/74853-06-8.gif)