A0769212
Atenolol , ≥98%,powder , 29122-68-7
Synonym(s):
(±)-4-[2-Hydroxy-3-[(1-methylethyl)amino]propoxy]benzeneacetamide;4-[2′-Hydroxy-3′-(isopropylamino)propoxy]phenylacetamide;Atenolol
CAS NO.:29122-68-7
Empirical Formula: C14H22N2O3
Molecular Weight: 266.34
MDL number: MFCD00057645
EINECS: 249-451-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB79.20 | In Stock |
|
| 5G | RMB149.60 | In Stock |
|
| 25g | RMB356.00 | In Stock |
|
| 100g | RMB1015.20 | In Stock |
|
| 500g | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154°C |
| Boiling point: | 409.54°C (rough estimate) |
| Density | 1.0807 (rough estimate) |
| refractive index | 1.5110 (estimate) |
| Flash point: | 2℃ |
| storage temp. | 2-8°C |
| solubility | H2O: 0.3 mg/mL |
| form | powder |
| pka | 9.6(at 25℃) |
| color | white to off-white |
| Water Solubility | 13.5mg/L(25 ºC) |
| Merck | 14,859 |
| BCS Class | 3 |
| InChI | 1S/C14H22N2O3/c1-10(2)16-8-12(17)9-19-13-5-3-11(4-6-13)7-14(15)18/h3-6,10,12,16-17H,7-9H2,1-2H3,(H2,15,18) |
| InChIKey | METKIMKYRPQLGS-UHFFFAOYSA-N |
| SMILES | N(C(C)C)CC(O)COc1ccc(cc1)CC(=O)N |
| CAS DataBase Reference | 29122-68-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Atenolol(29122-68-7) |
| EPA Substance Registry System | Benzeneacetamide, 4-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]- (29122-68-7) |
Description and Uses
It is used for preventing angina pectoris.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302+H312+H332-H319 |
| Precautionary statements | P210-P261-P302+P352+P312-P304+P340+P312-P337+P313-P403+P235 |
| Hazard Codes | Xn,F |
| Risk Statements | 22-36/37/38-20/21/22-36-11 |
| Safety Statements | 22-24/25-36-26-36/37-16 |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 2 |
| RTECS | AC3600000 |
| HazardClass | IRRITANT |
| HS Code | 29242995 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 29122-68-7(Hazardous Substances Data) |
| Toxicity | LD50 in mice, rats (mg/kg): 2000, 3000 orally; 98.7, 59.24 i.v. (Fitzgerald) |




