A0778512
AZD1208 , ≥98% , 1204144-28-4
CAS NO.：1204144-28-4
Empirical Formula: C21H21N3O2S
Molecular Weight: 379.48
MDL number: MFCD25976757
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB386.40 | In Stock |
|
| 25MG | RMB1199.20 | In Stock |
|
| 100MG | RMB3570.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >220°C (dec.) |
| Density | 1.307±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly) |
| pka | 7.39±0.20(Predicted) |
| form | Solid |
| color | Off-White to Pale Yellow |
| InChIKey | MCUJKPPARUPFJM-UWCCDQBKSA-N |
| SMILES | S1/C(=C\C2C=CC=C(C3=CC=CC=C3)C=2N2CCC[C@@H](N)C2)/C(=O)NC1=O |
Description and Uses
AZD1208 is a potent, and orally available Pim kinase inhibitor.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |
