A0778650
Perfluoro(2-methyl-3-oxahexanoic)acid , 97% , 13252-13-6
CAS NO.：13252-13-6
Empirical Formula: C6HF11O3
Molecular Weight: 330.05
MDL number: MFCD00236734
EINECS: 236-236-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB293.60 | In Stock |
|
| 25g | RMB1036.00 | In Stock |
|
| 100g | RMB2764.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 60°C 10mm |
| Density | 1.748±0.06 g/cm3(Predicted) |
| Flash point: | 60°C/10mm |
| storage temp. | 2-8°C |
| solubility | Benzene (Slightly), Chloroform (Sparingly), DMSO (Sparingly), Methanol (Slightly) |
| form | liquid |
| pka | -1.36±0.10(Predicted) |
| color | Colourless |
| Major Application | PFAS testing |
| InChI | 1S/C6HF11O3/c7-2(1(18)19,4(10,11)12)20-6(16,17)3(8,9)5(13,14)15/h(H,18,19) |
| InChIKey | CSEBNABAWMZWIF-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(=O)O |
| EPA Substance Registry System | Hexafluoropropylene oxide dimer acid (13252-13-6) |
Description and Uses
2,3,3,3-Tetrafluoro-2-(1,1,2,2,3,3,3,heptafluoropropoxy)propanoic Acid is a standard for environmental testing and research. Identification of novel perfluoroalkyl ether carboxylic acids and sulfonic acids in natural waters using accurate mass time-of-flight mass spectrometry.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P310-P260 |
| target organs | Respiratory system |
| Hazard Codes | C,Xi |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3265 |
| WGK Germany | WGK 3 |
| Hazard Note | Corrosive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2918999090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
