A0780212
2-Amino-3-methylbenzoic acid , 99% , 4389-45-1
Synonym(s):
3-Methylanthranilic acid
CAS NO.:4389-45-1
Empirical Formula: C8H9NO2
Molecular Weight: 151.16
MDL number: MFCD00007745
EINECS: 224-505-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB22.40 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB35.20 | In Stock |
|
| 100G | RMB112.80 | In Stock |
|
| 500g | RMB454.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 174-177 °C (lit.) |
| Boiling point: | 273.17°C (rough estimate) |
| Density | 1.2023 (rough estimate) |
| refractive index | 1.5810 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| pka | 5.01±0.10(Predicted) |
| form | Crystalline Powder |
| color | Pink to gray-brown |
| BRN | 2359694 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C8H9NO2/c1-5-3-2-4-6(7(5)9)8(10)11/h2-4H,9H2,1H3,(H,10,11) |
| InChIKey | WNAJXPYVTFYEST-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(C)=C1N |
| CAS DataBase Reference | 4389-45-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Amino-3-methylbenzoic acid(4389-45-1) |
Description and Uses
2-Amino-3-methylbenzoic acid is a metabolite of Lidocaine (L397800), an antiarrythmic drug that is used to treat patients with ventricular fibrillation. 2-Amino-3-methylbenzoic acid has potential herbicidal activity, and is also used as a reagent to synthesize Ropicavaine (R675000), a local anasthetic.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H302 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |



