A0781212
Azinphos-methyl Standard , 1000ug/mlinAcetone , 86-50-0
Synonym(s):
Guthion;Methyltriazotin
CAS NO.:86-50-0
Empirical Formula: C10H12N3O3PS2
Molecular Weight: 317.32
MDL number: MFCD00041814
EINECS: 201-676-1
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 73℃ |
| Boiling point: | 421.3±55.0 °C(Predicted) |
| Density | 1.44 g/cm3 (20℃) |
| vapor pressure | 5.0 x 10-7 Pa (20 °C) |
| refractive index | 1.6115 (589.3 nm 76℃) |
| storage temp. | 0-6°C |
| pka | -2.60±0.20(Predicted) |
| Water Solubility | 28 mg l-1(20 °C) |
| form | solid |
| color | Crystals or brown, waxy solid |
| Merck | 13,915 |
| BRN | 280476 |
| Exposure limits | NIOSH REL: 0.2 mg/m3; OSHA PEL: TWA 0.2 mg/m3; ACGIH TLV:
TWA 0.2 mg/m3. |
| Major Application | agriculture environmental |
| InChI | 1S/C10H12N3O3PS2/c1-15-17(18,16-2)19-7-13-10(14)8-5-3-4-6-9(8)11-12-13/h3-6H,7H2,1-2H3 |
| InChIKey | CJJOSEISRRTUQB-UHFFFAOYSA-N |
| SMILES | COP(=S)(OC)SCN1N=Nc2ccccc2C1=O |
| LogP | 2.750 |
| CAS DataBase Reference | 86-50-0(CAS DataBase Reference) |
| EPA Substance Registry System | Azinphos-methyl (86-50-0) |
Description and Uses
Azinphos-methyl is a brown, waxy solid, orcolorless, crystalline material. Its technical form is a brownwaxy solid. Molecular weight= 317.34; Freezing/Meltingpoint=73°74℃; Vapor pressure= 2.0 3 10 2 7 mmHg.Hazard Identification (based on NFPA-704 M RatingSystem): Health 3, Flammability 0, Reactivity 0. Practicallyinsoluble in water.
Nonsystemic insecticide and acaricide for control of insects pests in blueberry, grape, maize, vegetable, cotton and citrus crops.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H300+H330-H311-H317-H410 |
| Precautionary statements | P260-P264-P273-P280-P302+P352+P312-P304+P340+P310 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T+,N |
| Risk Statements | 24-26/28-43-50/53-28 |
| Safety Statements | 28-36/37-45-60-61 |
| RIDADR | 2783 |
| OEB | C |
| OEL | TWA: 0.2 mg/m3 [skin] |
| WGK Germany | 3 |
| RTECS | TE1925000 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Storage Class | 6.1A - Combustible, acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 2 Oral Acute Tox. 3 Dermal Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |
| Hazardous Substances Data | 86-50-0(Hazardous Substances Data) |
| Toxicity | LD50 in female rats (mg/kg): 11 orally; 220 dermally (Gaines) |
| IDLA | 10 mg/m3 |




