A0783412
2-Aminoimidazole sulfate , ≥98.0% , 1450-93-7
Synonym(s):
2-Imidazoleamine sulfate
CAS NO.：1450-93-7
Empirical Formula: C3H7N3O4S
Molecular Weight: 181.17
MDL number: MFCD00013162
EINECS: 215-918-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB32.00 | In Stock |
|
| 25G | RMB103.20 | In Stock |
|
| 100G | RMB376.80 | In Stock |
|
| 500g | RMB1500.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 270 °C (dec.) (lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Water (Sparingly) |
| form | Crystals or Crystalline Powder |
| color | Pale brown to brown |
| BRN | 4726750 |
| InChI | InChI=1S/2C3H5N3.H2O4S/c2*4-3-5-1-2-6-3;1-5(2,3)4/h2*1-2H,(H3,4,5,6);(H2,1,2,3,4) |
| InChIKey | KUWRLKJYNASPQZ-UHFFFAOYSA-N |
| SMILES | S(O)(O)(=O)=O.C1(N)=NC=CN1.C1(N)=NC=CN1 |
| CAS DataBase Reference | 1450-93-7(CAS DataBase Reference) |
Description and Uses
2-Aminoimidazole sulfate was used in the synthesis of chlorohydrin.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, KEEP COLD |
| HS Code | 29332990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
