A0783712
4-Amino-nicotinic acid , 98% , 7418-65-7
Synonym(s):
4-Amino-3-pyridinecarboxylic acid
CAS NO.：7418-65-7
Empirical Formula: C6H6N2O2
Molecular Weight: 138.12
MDL number: MFCD00234183
EINECS: 628-821-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB108.80 | In Stock |
|
| 5G | RMB327.20 | In Stock |
|
| 25G | RMB1055.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 307-312 °C |
| Boiling point: | 253.51°C (rough estimate) |
| Density | 1.3471 (rough estimate) |
| refractive index | 1.5100 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in aqueous acid and base. |
| form | Powder |
| pka | 2.94±0.10(Predicted) |
| color | Cream to yellow |
| InChI | InChI=1S/C6H6N2O2/c7-5-1-2-8-3-4(5)6(9)10/h1-3H,(H2,7,8)(H,9,10) |
| InChIKey | IASBMUIXBJNMDW-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(N)=C1C(O)=O |
| CAS DataBase Reference | 7418-65-7(CAS DataBase Reference) |
Description and Uses
4-amino Nicotinic acid is a synthetic intermediate that has been used in various syntheses.
4-Aminonicotinic acid has been used in the preparation of 2-methyl-pyrido-oxazine. It is also used as pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | N |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
