A0789912
Albendazole Oxide , ≥98% , 54029-12-8
Synonym(s):
Albendazole oxide;Albendazole sulfoxide;Methyl [5-(propane-1-sulfinyl)-1H-benzoimidazol-2-yl]-carbamate;Ricobendazole
CAS NO.:54029-12-8
Empirical Formula: C12H15N3O3S
Molecular Weight: 281.33
MDL number: MFCD00797922
EINECS: 628-805-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.00 | In Stock |
|
| 5G | RMB136.00 | In Stock |
|
| 25G | RMB355.20 | In Stock |
|
| 100G | RMB1048.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 226-228°C dec. |
| Density | 1.40 |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly, Heated), Methanol (Slightly) |
| form | Solid |
| pka | pKa 3.28±0.01(H2O t=25.0±0.1 I=0.1(NaCl))(Approximate); 9.93±0.01(H2O t=25.0±0.1 I=0.1(NaCl))(Approximate) |
| color | colorless or white |
| Water Solubility | 62mg/L(25 ºC) |
| BRN | 677664 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | 1S/C12H15N3O3S/c1-3-6-19(17)8-4-5-9-10(7-8)14-11(13-9)15-12(16)18-2/h4-5,7H,3,6H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | VXTGHWHFYNYFFV-UHFFFAOYSA-N |
| SMILES | CCCS(=O)c1ccc2[nH]c(NC(=O)OC)nc2c1 |
| CAS DataBase Reference | 54029-12-8(CAS DataBase Reference) |
Description and Uses
Tubulin polymerization or assembled inhibitors
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H361d-H373-H410 |
| Precautionary statements | P201-P202-P273-P280-P302+P352-P308+P313 |
| target organs | Adrenal gland,spleen,male reproductive organs,Blood |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | FD1080000 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Repr. 2 Skin Sens. 1 STOT RE 2 Oral |







