A0790012
Adrenalone HCl Hydrate , ≥98% , 62-13-5
Synonym(s):
3′,4′-Dihydroxy-2-(methylamino)acetophenone hydrochloride;Adrenalone hydrochloride
CAS NO.:62-13-5
Empirical Formula: C9H12ClNO3
Molecular Weight: 217.65
MDL number: MFCD00035075
EINECS: 200-525-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB52.80 | In Stock |
|
| 5G | RMB157.60 | In Stock |
|
| 25G | RMB435.20 | In Stock |
|
| 100g | RMB1575.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 244-249 °C (dec.) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Off-White |
| Water Solubility | almost transparency |
| Merck | 14,171 |
| BRN | 3916102 |
| InChI | InChI=1S/C9H11NO3.ClH/c1-10-5-9(13)6-2-3-7(11)8(12)4-6;/h2-4,10-12H,5H2,1H3;1H |
| InChIKey | CSRRBDMYOUQTCO-UHFFFAOYSA-N |
| SMILES | C1(C(=O)CNC)=CC=C(O)C(O)=C1.Cl |
| CAS DataBase Reference | 62-13-5(CAS DataBase Reference) |
Description and Uses
Adrenalone displays antineoplastic activity and has been shown to inhibit growth of Ehrlich ascites tumors in mice.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | AM8225000 |
| F | 3-8-10-23 |
| HS Code | 29225090 |
| Storage Class | 11 - Combustible Solids |






