A0796312
3-Amino-4-fluorobenzoic Acid , ≥97.0%(T) , 2365-85-7
CAS NO.:2365-85-7
Empirical Formula: C7H6FNO2
Molecular Weight: 155.13
MDL number: MFCD00130055
EINECS: 219-122-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB54.72 | In Stock |
|
| 5G | RMB162.00 | In Stock |
|
| 25G | RMB566.64 | In Stock |
|
| 100G | RMB1140.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 184 °C |
| Boiling point: | 335.5±27.0 °C(Predicted) |
| Density | 1.430±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | Powder |
| pka | 4.30±0.10(Predicted) |
| color | Off-white |
| InChI | InChI=1S/C7H6FNO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,9H2,(H,10,11) |
| InChIKey | WFSPEVFSRUTRCN-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C(N)=C1 |
| CAS DataBase Reference | 2365-85-7(CAS DataBase Reference) |
Description and Uses
3-Amino-4-fluorobenzoic acid serves as a precursor for the synthesis of 3-amino-4-fluorobenzyl alcohol via reduction with BH3·THF[6].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| HazardClass | IRRITANT |
| HS Code | 2922498590 |




