A0796812
3-Amino-4-bromopyrazole , 97% , 16461-94-2
Synonym(s):
4-Bromo-1H-pyrazol-3-ylamine
CAS NO.：16461-94-2
Empirical Formula: C3H4BrN3
Molecular Weight: 161.99
MDL number: MFCD00053070
EINECS: 670-769-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB44.00 | In Stock |
|
| 5G | RMB157.60 | In Stock |
|
| 10g | RMB284.00 | In Stock |
|
| 25G | RMB599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 133-135°C |
| Boiling point: | 346.6±22.0 °C(Predicted) |
| Density | 2.039±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO, Water |
| form | Solid |
| pka | 13.99±0.50(Predicted) |
| color | Grey Crystalline |
| BRN | 1617109 |
| InChI | InChI=1S/C3H4BrN3/c4-2-1-6-7-3(2)5/h1H,(H3,5,6,7) |
| InChIKey | OELYMZVJDKSMOJ-UHFFFAOYSA-N |
| SMILES | N1C=C(Br)C(N)=N1 |
| CAS DataBase Reference | 16461-94-2(CAS DataBase Reference) |
Description and Uses
4-Bromo-1H-pyrazol-3-amine is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29331990 |
