A0800212
Carbazochrome , ≥99.0%(HPLC) , 69-81-8
Synonym(s):
2-(1,2,3,6-tetrahydro-3-hydroxy-1-methyl-6-oxoindol-5-ylidene)-hydrazinecarboxamide;3-Hydroxy-1-methyl-5,6-indolindione-5-semicarbazone;Adrenochrome monosemicarbazone;Carbazochrome;NSC 73742
CAS NO.:69-81-8
Empirical Formula: C10H12N4O3
Molecular Weight: 236.23
MDL number: MFCD00130253
EINECS: 200-717-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB123.20 | In Stock |
|
| 25G | RMB387.20 | In Stock |
|
| 100g | RMB971.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 203° (dec) |
| Density | 1.63±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | DMSO (Slightly), Water (Slightly, Heated) |
| pka | 12.38±0.40(Predicted) |
| form | Solid |
| color | Dark Orange to Very Dark Orange |
| Water Solubility | Water: 5 mg/mL (21.17 mM; ultrasonic and adjust pH to 12 with NaOH) |
| Merck | 14,172 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C10H12N4O3/c1-14-4-9(16)5-2-6(12-13-10(11)17)8(15)3-7(5)14/h2-3,9,16H,4H2,1H3,(H3,11,13,17) |
| InChIKey | XSXCZNVKFKNLPR-UHFFFAOYSA-N |
| SMILES | N(C(N)=O)N=C1C(=O)C=C2C(=C1)C(O)CN2C |
| CAS DataBase Reference | 69-81-8(CAS DataBase Reference) |
Description and Uses
Carbazochrome is an oxidation product of Epinephrine [E588580]) that improves microcirculatory tone. Derivatives such as carbazochrome salicylate and carbazochrome sodium sulfonate, are used as hemostats and treatment to prevent dengue shock syndrome, respectively.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362-P403+P233-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 2 |
| RTECS | NM1925500 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |





